Debraz11 Debraz11

04-04-2017
Mathematics

contestada

a sales person earns £16000 a year. She is offered a rise of 22%. How much will she now receive?

Respuesta :

lshaffer16 lshaffer16

04-04-2017

22% of 16000 is 3520
16000 + 3520 = 19520

Answer Link

Otras preguntas

12x1 12x2 12x3 12x4 djdjdjjfjfir

What does Islam mean in Arabic?

When we experience one sensation for an extended period of time, the receptor neurons stop firing and our body gets used to it. What is this called? Question 4

cosec(6b+pi/8)=sec(2b-pi/8)

Which equation is an identity? A.8x+9=8x-3 B.7x-2=8x+4-x C.11-(2x+3)= -2x-8 D.5x+8-x=6x-2(x-4)

How to determine oxidation numbers

Explain why is there no chemical equation to describe what happens when water evaporates?

Which of the following best describes the way society felt about the 20th century after World War I? A hopeless B optimistic C confident D rejuvenated

50 POINTS! AND WILL GIVE BRAINLIEST !!!!!! PLZ I AM BEGGING YOU HELP ME HERE! THE ART OF SENTENCE WRITING Answer the following questions. 1) Choose the correc

1. Which war led England to begin taxing its colonies in the Americas? (1 point) the War of 1812 the First World War the French and Indian War the Mexica