Seudónimo Seudónimo
  • 03-02-2017
  • Mathematics
contestada

rewrite the expression as a multiple of a sum of two numbers with no common factor.
30 + 12

rewrite the expression as a multiple of a sum of two numbers with no common factor 30 12 class=

Respuesta :

Аноним Аноним
  • 03-02-2017
6x7=42 is the same as 30+12=42
Answer Link
Аноним Аноним
  • 03-02-2017
42 like 6x7=42 it is the same okay do you jet it now ?
Answer Link

Otras preguntas

simplify the complex function (n-3/n^2+6n+8)/(n+1/n+2)
what is 8.64E9 in scientific notation?
What does the name 2–butene tell you about this hydrocarbon's molecular structure?
Which of the following is not a problem with commodity money? A. Value B. Portability C. Uniformity D. Divisibility
In 1965, which u.s. president ordered a bombing campaign against north vietnam and sent american ground troops to bolster the south vietnam army?
Why is the amoeba considered an outgroup in this cladogram?
Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)
n which type of reproduction can cells divide through the process of mitosis? chromosome duplication sexual reproduction gamete formation asexual reproduction
When examining a newborn for developmental hip dysplasia, which motion would the newborn's hip be unable to accomplish?
How many significant figures does the number 83.400 have?