mleah9454 mleah9454

01-06-2021
Mathematics

contestada

Simplify by combining like terms: 3x + 2 + x + 7
A. 5x + 7
B. 3x + 9
C. 4x + 9
D. 6x + 7

Respuesta :

sienabrock sienabrock

01-06-2021

4x +9

3x and x are like terms
And 2 and 7 are like terms

Hope this helps :D

Answer Link

Otras preguntas

The importance of cold war to the developing countries

Please help me please

Explain why the formation of hydrogen bonds between water molecules is important for the survival of living things.

QUESTION 7 Todd bought a guitar practice amplifier for $229.99. He paid $30 down and $25 a month for 9 months. What was his total cost? $284.99 $255 $25.01 $229

Py+qy=-4y+8 what is the solution for y

Charlize was sitting at her desk playing on her phone as if she didn't have anything to do. * O simple O complex O compound-complex O compound

The length of a Rectangle is 5/6 feet. The width is 3/8 feet. How much greater is the length of the rectangle than the width? A) 1/12 ft B) 1/4 ft C) 11/24 ft D

Which statement about 6x2 + 7x – 10 is true?

cosec(6b+pi/8)=sec(2b-pi/8)

you have an 7-by-5-inch photo of the math club that must be reduced to a size of 5.6 inches by 4 inches for the school yearbook. what percent does the photo nee