marciasamplina465 marciasamplina465

01-05-2021
Mathematics

contestada

Which transformation(s) preserve the size & shape of the pre-image?
SELECT ALL THAT APPLY *
Translation
Rotation
Reflection
None

Respuesta :

Chidiebere Chidiebere

01-05-2021

Answer:

rotation and reflection

Answer Link

Otras preguntas

The function gx) = x^2is transformed to obtain function hr. h(x) = g(x-3). Which statement describes how the graph of h is different from the graph of g? A. The

Jordan says that he wants to make as much money as he can after college so that he can retire at age 45. He plans to "save every dime" that is not needed for hi

If Colombia spends 2 hours producing coffee and 6 hours producing oranges, and Cuba spends 3 hours producing coffee and 1 hour producing oranges, which of the f

List the sides in order from the largest to the smallest. A. XY, YW, WX B. XY, WX, YW C. WX, YW, XY D. WX, XY, YW

What is the author’s purpose for including this sentence? "Shallow understanding from people of good will is more frustrating than absolute misunderstanding fro

S100A8 sex chromosome? yes or no

what is the similarity between ordinary and special resolution

A string passing over a smooth pulley carries a stone at one end. While its other end is attached to a vibrating tuning fork and the string vibrates forming 8 l

HELP! URGENT! Alice wrote three consecutive even numbers. The sum of these numbers was 252. Pat wrote three consecutive odd numbers. Pat's numbers were larger t

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl