taralynnn6973 taralynnn6973
  • 03-08-2020
  • Chemistry
contestada

What is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?

Respuesta :

pstnonsonjoku
pstnonsonjoku pstnonsonjoku
  • 05-08-2020

Answer:

ethylpentanoate

Explanation:

Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.

The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;

CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)

The name of the compound formed is ethylpentanoate.

Answer Link

Otras preguntas

-3=z-8 Solve and answer the equation
I have some Spanish homework and HELP IS NEEDED! One of the questions is "Como se escribe tu nombre?" I don't understand what this question is asking for. Help
Are the angles with the given measures complementary, supplementary, or neither? m∠R = 43° and m∠S = 57° A. complementary B. supplementary C. neither
what factors contribute to global winds?
What is the greatest common factor of 12 and 16?
Which achievement was Giovanni Caboto, also known as John Cabot, known for? A. He reached North America before Columbus but was unable to prove that he had foun
The location of a post office is marked at (2,2) on a coordinate grid. Which point is about 18 units from the location of the post office? L(-12,9) M(12,9) N(1
Why do we call the land Mesopotamia
Is MgC2 an organic, acid, inorganic compound?
what is the opposite of dreamy-eyed